C23H32ClFN4O2 — CID 139495508
(2R)-6-[[(1R)-1-(5-chloro-2-pyridinyl)-2-methylpropyl]amino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide (PubChem CID 139495508) has the molecular formula C23H32ClFN4O2 and a molecular weight of 450.99 g/mol. Its IUPAC name is (2R)-6-[[(1R)-1-(5-chloro-2-pyridinyl)-2-methylpropyl]amino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide.
| Compound Name | (2R)-6-[[(1R)-1-(5-chloro-2-pyridinyl)-2-methylpropyl]amino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 139495508 |
| Molecular Formula | C23H32ClFN4O2 |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (2R)-6-[[(1R)-1-(5-chloro-2-pyridinyl)-2-methylpropyl]amino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide |
| SMILES | Cc1cc(N[C@H](CCCCN[C@@H](c2ccc(Cl)cn2)C(C)C)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C23H32ClFN4O2/c1-14(2)22(19-9-8-17(24)13-27-19)26-10-6-5-7-20(23(30)29-31)28-18-11-15(3)21(25)16(4)12-18/h8-9,11-14,20,22,26,28,31H,5-7,10H2,1-4H3,(H,29,30)/t20-,22-/m1/s1 |
| InChIKey | WRZDAHZXSIOMKK-IFMALSPDSA-N |
| XLogP | 4.93 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|