C15H23FN2O2 — CID 69169743
methyl 6-amino-2-(4-fluoro-3,5-dimethylanilino)hexanoate (PubChem CID 69169743) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 6-amino-2-(4-fluoro-3,5-dimethylanilino)hexanoate.
| Compound Name | methyl 6-amino-2-(4-fluoro-3,5-dimethylanilino)hexanoate |
|---|---|
| PubChem CID | 69169743 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | methyl 6-amino-2-(4-fluoro-3,5-dimethylanilino)hexanoate |
| SMILES | COC(=O)C(CCCCN)Nc1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C15H23FN2O2/c1-10-8-12(9-11(2)14(10)16)18-13(15(19)20-3)6-4-5-7-17/h8-9,13,18H,4-7,17H2,1-3H3 |
| InChIKey | HCHZTWSEUKRHLJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|