C14H18ClF3N2O2 — CID 162612299
ethyl (2R)-5-amino-2-[3-chloro-5-(trifluoromethyl)anilino]pentanoate (PubChem CID 162612299) has the molecular formula C14H18ClF3N2O2 and a molecular weight of 338.76 g/mol. Its IUPAC name is ethyl (2R)-5-amino-2-[3-chloro-5-(trifluoromethyl)anilino]pentanoate.
| Compound Name | ethyl (2R)-5-amino-2-[3-chloro-5-(trifluoromethyl)anilino]pentanoate |
|---|---|
| PubChem CID | 162612299 |
| Molecular Formula | C14H18ClF3N2O2 |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | ethyl (2R)-5-amino-2-[3-chloro-5-(trifluoromethyl)anilino]pentanoate |
| SMILES | CCOC(=O)[C@@H](CCCN)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18ClF3N2O2/c1-2-22-13(21)12(4-3-5-19)20-11-7-9(14(16,17)18)6-10(15)8-11/h6-8,12,20H,2-5,19H2,1H3/t12-/m1/s1 |
| InChIKey | AOZOYVHNTCLWGX-GFCCVEGCSA-N |
| XLogP | 3.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |