C12H13ClF3NO2 — CID 170885231
ethyl 2-amino-3-[3-chloro-5-(trifluoromethyl)phenyl]propanoate (PubChem CID 170885231) has the molecular formula C12H13ClF3NO2 and a molecular weight of 295.69 g/mol. Its IUPAC name is ethyl 2-amino-3-[3-chloro-5-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[3-chloro-5-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 170885231 |
| Molecular Formula | C12H13ClF3NO2 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | ethyl 2-amino-3-[3-chloro-5-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF3NO2/c1-2-19-11(18)10(17)5-7-3-8(12(14,15)16)6-9(13)4-7/h3-4,6,10H,2,5,17H2,1H3 |
| InChIKey | YOWHGPURULNRIK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |