C14H14F4O3 — CID 67404141
ethyl 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-oxobutanoate (PubChem CID 67404141) has the molecular formula C14H14F4O3 and a molecular weight of 306.26 g/mol. Its IUPAC name is ethyl 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-oxobutanoate.
| Compound Name | ethyl 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 67404141 |
| Molecular Formula | C14H14F4O3 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | ethyl 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Cc1cc(F)cc(C(F)(F)F)c1)C(C)=O |
| InChI | InChI=1S/C14H14F4O3/c1-3-21-13(20)12(8(2)19)6-9-4-10(14(16,17)18)7-11(15)5-9/h4-5,7,12H,3,6H2,1-2H3 |
| InChIKey | GXTKWMCMQOIZLM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|