C12H13F4NO2 — CID 115350555
methyl 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]propanoate (PubChem CID 115350555) has the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. Its IUPAC name is methyl 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]propanoate.
| Compound Name | methyl 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]propanoate |
|---|---|
| PubChem CID | 115350555 |
| Molecular Formula | C12H13F4NO2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | methyl 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]propanoate |
| SMILES | COC(=O)C(C)NCc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F4NO2/c1-7(11(18)19-2)17-6-8-3-9(12(14,15)16)5-10(13)4-8/h3-5,7,17H,6H2,1-2H3 |
| InChIKey | FGGPJTFTGWQSHV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |