C13H16F4N2O — CID 115282732
2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-N-propan-2-ylacetamide (PubChem CID 115282732) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 115282732 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNCc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F4N2O/c1-8(2)19-12(20)7-18-6-9-3-10(13(15,16)17)5-11(14)4-9/h3-5,8,18H,6-7H2,1-2H3,(H,19,20) |
| InChIKey | CBZFMVPEMNLUIM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |