C12H14F4N2O — CID 115282805
3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-N-methylpropanamide (PubChem CID 115282805) has the molecular formula C12H14F4N2O and a molecular weight of 278.25 g/mol. Its IUPAC name is 3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-N-methylpropanamide.
| Compound Name | 3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 115282805 |
| Molecular Formula | C12H14F4N2O |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNCc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F4N2O/c1-17-11(19)2-3-18-7-8-4-9(12(14,15)16)6-10(13)5-8/h4-6,18H,2-3,7H2,1H3,(H,17,19) |
| InChIKey | LNQDELYZUTXRNV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|