C13H13ClF3NO2 — CID 104920850
methyl 2-[3-chloro-5-(trifluoromethyl)anilino]-2-cyclopropylacetate (PubChem CID 104920850) has the molecular formula C13H13ClF3NO2 and a molecular weight of 307.70 g/mol. Its IUPAC name is methyl 2-[3-chloro-5-(trifluoromethyl)anilino]-2-cyclopropylacetate.
| Compound Name | methyl 2-[3-chloro-5-(trifluoromethyl)anilino]-2-cyclopropylacetate |
|---|---|
| PubChem CID | 104920850 |
| Molecular Formula | C13H13ClF3NO2 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | methyl 2-[3-chloro-5-(trifluoromethyl)anilino]-2-cyclopropylacetate |
| SMILES | COC(=O)C(Nc1cc(Cl)cc(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C13H13ClF3NO2/c1-20-12(19)11(7-2-3-7)18-10-5-8(13(15,16)17)4-9(14)6-10/h4-7,11,18H,2-3H2,1H3 |
| InChIKey | JNQLXNLMNJNCEC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |