C16H19NOS — CID 54260864
S-ethyl 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]ethanethioate (PubChem CID 54260864) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is S-ethyl 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]ethanethioate.
| Compound Name | S-ethyl 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]ethanethioate |
|---|---|
| PubChem CID | 54260864 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | S-ethyl 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]ethanethioate |
| SMILES | CCSC(=O)Cc1ccc(-n2c(C)ccc2C)cc1 |
| InChI | InChI=1S/C16H19NOS/c1-4-19-16(18)11-14-7-9-15(10-8-14)17-12(2)5-6-13(17)3/h5-10H,4,11H2,1-3H3 |
| InChIKey | RDKGJUHGCQEKRB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|