C19H26N2O2 — CID 72722591
tert-butyl N-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]ethyl]carbamate (PubChem CID 72722591) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 72722591 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | tert-butyl N-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]ethyl]carbamate |
| SMILES | Cc1ccc(C)n1-c1ccc(CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O2/c1-14-6-7-15(2)21(14)17-10-8-16(9-11-17)12-13-20-18(22)23-19(3,4)5/h6-11H,12-13H2,1-5H3,(H,20,22) |
| InChIKey | OPSHQAVPTCMJRF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|