C18H18N2 — CID 804638
4-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methyl]pyridine (PubChem CID 804638) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methyl]pyridine.
| Compound Name | 4-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methyl]pyridine |
|---|---|
| PubChem CID | 804638 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methyl]pyridine |
| SMILES | Cc1ccc(C)n1-c1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C18H18N2/c1-14-3-4-15(2)20(14)18-7-5-16(6-8-18)13-17-9-11-19-12-10-17/h3-12H,13H2,1-2H3 |
| InChIKey | DVZBAQQVUODCFY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|