C14H24N5NaO5S — CID 87704712
sodium;(2S)-2,6-diaminohexanoic acid;N-[4-(dimethylamino)phenyl]iminosulfamate (PubChem CID 87704712) has the molecular formula C14H24N5NaO5S and a molecular weight of 397.43 g/mol. Its IUPAC name is sodium;(2S)-2,6-diaminohexanoic acid;N-[4-(dimethylamino)phenyl]iminosulfamate.
| Compound Name | sodium;(2S)-2,6-diaminohexanoic acid;N-[4-(dimethylamino)phenyl]iminosulfamate |
|---|---|
| PubChem CID | 87704712 |
| Molecular Formula | C14H24N5NaO5S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | sodium;(2S)-2,6-diaminohexanoic acid;N-[4-(dimethylamino)phenyl]iminosulfamate |
| SMILES | CN(C)c1ccc(/N=N/S(=O)(=O)[O-])cc1.NCCCC[C@H](N)C(=O)O.[Na+] |
| InChI | InChI=1S/C8H11N3O3S.C6H14N2O2.Na/c1-11(2)8-5-3-7(4-6-8)9-10-15(12,13)14;7-4-2-1-3-5(8)6(9)10;/h3-6H,1-2H3,(H,12,13,14);5H,1-4,7-8H2,(H,9,10);/q;;+1/p-1/b10-9+;;/t;5-;/m.0./s1 |
| InChIKey | SSRFOEHUHMGJLS-AVALONBMSA-M |
| XLogP | -2.17 |
| TPSA | 174.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|