C38H54FN6O9PS — CID 123889883
[4-[2-[6-[[3-[3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-3-methylbutoxy]-3-methylbutanoyl]amino]hexylamino]-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate (PubChem CID 123889883) has the molecular formula C38H54FN6O9PS and a molecular weight of 820.92 g/mol. Its IUPAC name is [4-[2-[6-[[3-[3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-3-methylbutoxy]-3-methylbutanoyl]amino]hexylamino]-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[2-[6-[[3-[3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-3-methylbutoxy]-3-methylbutanoyl]amino]hexylamino]-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 123889883 |
| Molecular Formula | C38H54FN6O9PS |
| Molecular Weight | 820.92 g/mol |
| Exact Mass | 820.34 |
| IUPAC Name | [4-[2-[6-[[3-[3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-3-methylbutoxy]-3-methylbutanoyl]amino]hexylamino]-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)NC(C)(C)CCOC(C)(C)CC(=O)NCCCCCCNC(=O)C(F)c3ccc(OP(=O)(O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H54FN6O9PS/c1-37(2,44-56(51,52)33-21-15-30(16-22-33)43-42-29-13-17-31(18-14-29)45(5)6)23-26-53-38(3,4)27-34(46)40-24-9-7-8-10-25-41-36(47)35(39)28-11-19-32(20-12-28)54-55(48,49)50/h11-22,35,44H,7-10,23-27H2,1-6H3,(H,40,46)(H,41,47)(H2,48,49,50)/b43-42+ |
| InChIKey | DVHJDRVULCNZBV-HBSCQBRPSA-N |
| XLogP | 6.78 |
| TPSA | 208.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.92 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|