C30H41ClN4O6S — CID 66871362
N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3-[[4-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-2-yl]phenyl]sulfonylamino]propanamide (PubChem CID 66871362) has the molecular formula C30H41ClN4O6S and a molecular weight of 621.20 g/mol. Its IUPAC name is N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3-[[4-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-2-yl]phenyl]sulfonylamino]propanamide.
| Compound Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3-[[4-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-2-yl]phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 66871362 |
| Molecular Formula | C30H41ClN4O6S |
| Molecular Weight | 621.20 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3-[[4-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-2-yl]phenyl]sulfonylamino]propanamide |
| SMILES | CN(C)c1ccc(-c2cnc(-c3ccc(S(=O)(=O)NCCC(=O)NCCOCCOCCCCCCCl)cc3)o2)cc1 |
| InChI | InChI=1S/C30H41ClN4O6S/c1-35(2)26-11-7-24(8-12-26)28-23-33-30(41-28)25-9-13-27(14-10-25)42(37,38)34-17-15-29(36)32-18-20-40-22-21-39-19-6-4-3-5-16-31/h7-14,23,34H,3-6,15-22H2,1-2H3,(H,32,36) |
| InChIKey | FEWXHAJCUUDLRR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|