C13H16N2O4S — CID 20958826
N-(2-methoxyethyl)-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide (PubChem CID 20958826) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 20958826 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-(2-methoxyethyl)-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(-c2cnc(C)o2)cc1 |
| InChI | InChI=1S/C13H16N2O4S/c1-10-14-9-13(19-10)11-3-5-12(6-4-11)20(16,17)15-7-8-18-2/h3-6,9,15H,7-8H2,1-2H3 |
| InChIKey | KZTWVTZSWQBLFZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|