C23H28N2O3S — CID 19258829
N-octyl-4-(5-phenyl-1,3-oxazol-2-yl)benzenesulfonamide (PubChem CID 19258829) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-octyl-4-(5-phenyl-1,3-oxazol-2-yl)benzenesulfonamide.
| Compound Name | N-octyl-4-(5-phenyl-1,3-oxazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 19258829 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-octyl-4-(5-phenyl-1,3-oxazol-2-yl)benzenesulfonamide |
| SMILES | CCCCCCCCNS(=O)(=O)c1ccc(-c2ncc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C23H28N2O3S/c1-2-3-4-5-6-10-17-25-29(26,27)21-15-13-20(14-16-21)23-24-18-22(28-23)19-11-8-7-9-12-19/h7-9,11-16,18,25H,2-6,10,17H2,1H3 |
| InChIKey | UHWBTQPQTSTSLC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|