C24H30N4O4S — CID 142884261
4-methoxy-3-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]amino]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide (PubChem CID 142884261) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is 4-methoxy-3-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]amino]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 4-methoxy-3-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]amino]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 142884261 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-methoxy-3-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]amino]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCN2CCCC2)cc1Nc1ncc(-c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C24H30N4O4S/c1-18-6-8-19(9-7-18)23-17-25-24(32-23)27-21-16-20(10-11-22(21)31-2)33(29,30)26-12-5-15-28-13-3-4-14-28/h6-11,16-17,26H,3-5,12-15H2,1-2H3,(H,25,27) |
| InChIKey | WMECVWNRZGZNGS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|