C26H37N3O2S — CID 118462234
4-(4-methylphenyl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]benzenesulfonamide (PubChem CID 118462234) has the molecular formula C26H37N3O2S and a molecular weight of 455.67 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 4-(4-methylphenyl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 118462234 |
| Molecular Formula | C26H37N3O2S |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 4-(4-methylphenyl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2ccc(S(=O)(=O)NCCCN3CCC(N4CCCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H37N3O2S/c1-22-6-8-23(9-7-22)24-10-12-26(13-11-24)32(30,31)27-16-5-17-28-20-14-25(15-21-28)29-18-3-2-4-19-29/h6-13,25,27H,2-5,14-21H2,1H3 |
| InChIKey | HBVSLEIQCNPRAA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|