C27H36F3N3O2S — CID 126581729
N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 126581729) has the molecular formula C27H36F3N3O2S and a molecular weight of 523.67 g/mol. Its IUPAC name is N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126581729 |
| Molecular Formula | C27H36F3N3O2S |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCC(N2CCCCC2)CC1)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H36F3N3O2S/c28-27(29,30)24-10-6-22(7-11-24)23-8-12-26(13-9-23)36(34,35)31-16-2-5-17-32-20-14-25(15-21-32)33-18-3-1-4-19-33/h6-13,25,31H,1-5,14-21H2 |
| InChIKey | PSKZBRNFSNCOSU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|