C18H25F3N2 — CID 27267003
4-piperidin-1-yl-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 27267003) has the molecular formula C18H25F3N2 and a molecular weight of 326.41 g/mol. Its IUPAC name is 4-piperidin-1-yl-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 4-piperidin-1-yl-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 27267003 |
| Molecular Formula | C18H25F3N2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 4-piperidin-1-yl-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | FC(F)(F)c1ccc(CN2CCC(N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H25F3N2/c19-18(20,21)16-6-4-15(5-7-16)14-22-12-8-17(9-13-22)23-10-2-1-3-11-23/h4-7,17H,1-3,8-14H2 |
| InChIKey | UBOCWKZJKVWXEI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |