C26H33F3N4O — CID 123757094
N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-5-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide (PubChem CID 123757094) has the molecular formula C26H33F3N4O and a molecular weight of 474.57 g/mol. Its IUPAC name is N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-5-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide.
| Compound Name | N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-5-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123757094 |
| Molecular Formula | C26H33F3N4O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-5-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCCN1CCC(N2CCCCC2)CC1)c1ccc(-c2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C26H33F3N4O/c27-26(28,29)22-8-5-20(6-9-22)21-7-10-24(31-19-21)25(34)30-13-4-14-32-17-11-23(12-18-32)33-15-2-1-3-16-33/h5-10,19,23H,1-4,11-18H2,(H,30,34) |
| InChIKey | SGUHTCVYCCQQRF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|