C31H37F3N2O3S — CID 10210186
N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 10210186) has the molecular formula C31H37F3N2O3S and a molecular weight of 574.71 g/mol. Its IUPAC name is N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10210186 |
| Molecular Formula | C31H37F3N2O3S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CCOc1cc(C)ccc1C1CCN(CCCCNS(=O)(=O)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H37F3N2O3S/c1-3-39-30-22-23(2)6-15-29(30)26-16-20-36(21-17-26)19-5-4-18-35-40(37,38)28-13-9-25(10-14-28)24-7-11-27(12-8-24)31(32,33)34/h6-15,22,26,35H,3-5,16-21H2,1-2H3 |
| InChIKey | HLWYCBFFRQQFJS-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|