C17H18F3NO3S — CID 26539867
N-[2-(2-methoxy-5-methylphenyl)ethyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 26539867) has the molecular formula C17H18F3NO3S and a molecular weight of 373.40 g/mol. Its IUPAC name is N-[2-(2-methoxy-5-methylphenyl)ethyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(2-methoxy-5-methylphenyl)ethyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26539867 |
| Molecular Formula | C17H18F3NO3S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[2-(2-methoxy-5-methylphenyl)ethyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ccc(C)cc1CCNS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3NO3S/c1-12-3-8-16(24-2)13(11-12)9-10-21-25(22,23)15-6-4-14(5-7-15)17(18,19)20/h3-8,11,21H,9-10H2,1-2H3 |
| InChIKey | QMZZYQOLXRDQQK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |