C34H40ClN3O3 — CID 44532603
4-[(4-chlorobenzoyl)amino]-N-[4-[4-[2-(cyclopropylmethoxy)-4-methylphenyl]piperidin-1-yl]butyl]benzamide (PubChem CID 44532603) has the molecular formula C34H40ClN3O3 and a molecular weight of 574.17 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[2-(cyclopropylmethoxy)-4-methylphenyl]piperidin-1-yl]butyl]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[2-(cyclopropylmethoxy)-4-methylphenyl]piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44532603 |
| Molecular Formula | C34H40ClN3O3 |
| Molecular Weight | 574.17 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[2-(cyclopropylmethoxy)-4-methylphenyl]piperidin-1-yl]butyl]benzamide |
| SMILES | Cc1ccc(C2CCN(CCCCNC(=O)c3ccc(NC(=O)c4ccc(Cl)cc4)cc3)CC2)c(OCC2CC2)c1 |
| InChI | InChI=1S/C34H40ClN3O3/c1-24-4-15-31(32(22-24)41-23-25-5-6-25)26-16-20-38(21-17-26)19-3-2-18-36-33(39)27-9-13-30(14-10-27)37-34(40)28-7-11-29(35)12-8-28/h4,7-15,22,25-26H,2-3,5-6,16-21,23H2,1H3,(H,36,39)(H,37,40) |
| InChIKey | OTSOHZNRGXGVFC-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.17 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|