C35H36ClN3O4 — CID 10304114
[2-[1-[4-[[4-[(4-chlorobenzoyl)amino]benzoyl]amino]butyl]piperidin-4-yl]naphthalen-1-yl] acetate (PubChem CID 10304114) has the molecular formula C35H36ClN3O4 and a molecular weight of 598.14 g/mol. Its IUPAC name is [2-[1-[4-[[4-[(4-chlorobenzoyl)amino]benzoyl]amino]butyl]piperidin-4-yl]naphthalen-1-yl] acetate.
| Compound Name | [2-[1-[4-[[4-[(4-chlorobenzoyl)amino]benzoyl]amino]butyl]piperidin-4-yl]naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 10304114 |
| Molecular Formula | C35H36ClN3O4 |
| Molecular Weight | 598.14 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | [2-[1-[4-[[4-[(4-chlorobenzoyl)amino]benzoyl]amino]butyl]piperidin-4-yl]naphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(C2CCN(CCCCNC(=O)c3ccc(NC(=O)c4ccc(Cl)cc4)cc3)CC2)ccc2ccccc12 |
| InChI | InChI=1S/C35H36ClN3O4/c1-24(40)43-33-31-7-3-2-6-25(31)12-17-32(33)26-18-22-39(23-19-26)21-5-4-20-37-34(41)27-10-15-30(16-11-27)38-35(42)28-8-13-29(36)14-9-28/h2-3,6-17,26H,4-5,18-23H2,1H3,(H,37,41)(H,38,42) |
| InChIKey | MSLLAXRWTKJIBK-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.14 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|