C32H34F3N3O — CID 10280183
N-[4-[4-(1-methylindol-3-yl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 10280183) has the molecular formula C32H34F3N3O and a molecular weight of 533.64 g/mol. Its IUPAC name is N-[4-[4-(1-methylindol-3-yl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-(1-methylindol-3-yl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 10280183 |
| Molecular Formula | C32H34F3N3O |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | N-[4-[4-(1-methylindol-3-yl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cn1cc(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C32H34F3N3O/c1-37-22-29(28-6-2-3-7-30(28)37)25-16-20-38(21-17-25)19-5-4-18-36-31(39)26-10-8-23(9-11-26)24-12-14-27(15-13-24)32(33,34)35/h2-3,6-15,22,25H,4-5,16-21H2,1H3,(H,36,39) |
| InChIKey | RVEGIAIZRDRUHS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|