C33H40ClF3N2O3 — CID 44532847
N-[4-[4-[4-ethyl-2-(2-hydroxyethoxy)phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide;hydrochloride (PubChem CID 44532847) has the molecular formula C33H40ClF3N2O3 and a molecular weight of 605.14 g/mol. Its IUPAC name is N-[4-[4-[4-ethyl-2-(2-hydroxyethoxy)phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide;hydrochloride.
| Compound Name | N-[4-[4-[4-ethyl-2-(2-hydroxyethoxy)phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 44532847 |
| Molecular Formula | C33H40ClF3N2O3 |
| Molecular Weight | 605.14 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | N-[4-[4-[4-ethyl-2-(2-hydroxyethoxy)phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide;hydrochloride |
| SMILES | CCc1ccc(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)CC2)c(OCCO)c1.Cl |
| InChI | InChI=1S/C33H39F3N2O3.ClH/c1-2-24-5-14-30(31(23-24)41-22-21-39)27-15-19-38(20-16-27)18-4-3-17-37-32(40)28-8-6-25(7-9-28)26-10-12-29(13-11-26)33(34,35)36;/h5-14,23,27,39H,2-4,15-22H2,1H3,(H,37,40);1H |
| InChIKey | NWBIUVUNTTUCEP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.14 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|