C33H40ClN3O3 — CID 44532852
4-(4-cyanophenyl)-N-[4-[4-[4-ethyl-2-(2-hydroxyethoxy)phenyl]piperidin-1-yl]butyl]benzamide;hydrochloride (PubChem CID 44532852) has the molecular formula C33H40ClN3O3 and a molecular weight of 562.15 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N-[4-[4-[4-ethyl-2-(2-hydroxyethoxy)phenyl]piperidin-1-yl]butyl]benzamide;hydrochloride.
| Compound Name | 4-(4-cyanophenyl)-N-[4-[4-[4-ethyl-2-(2-hydroxyethoxy)phenyl]piperidin-1-yl]butyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 44532852 |
| Molecular Formula | C33H40ClN3O3 |
| Molecular Weight | 562.15 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 4-(4-cyanophenyl)-N-[4-[4-[4-ethyl-2-(2-hydroxyethoxy)phenyl]piperidin-1-yl]butyl]benzamide;hydrochloride |
| SMILES | CCc1ccc(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C#N)cc4)cc3)CC2)c(OCCO)c1.Cl |
| InChI | InChI=1S/C33H39N3O3.ClH/c1-2-25-7-14-31(32(23-25)39-22-21-37)29-15-19-36(20-16-29)18-4-3-17-35-33(38)30-12-10-28(11-13-30)27-8-5-26(24-34)6-9-27;/h5-14,23,29,37H,2-4,15-22H2,1H3,(H,35,38);1H |
| InChIKey | IXJNKQISFHFACQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.15 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|