C32H38F3N3O2 — CID 68516334
N-[4-[4-(2-ethoxy-4-methylanilino)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 68516334) has the molecular formula C32H38F3N3O2 and a molecular weight of 553.67 g/mol. Its IUPAC name is N-[4-[4-(2-ethoxy-4-methylanilino)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-(2-ethoxy-4-methylanilino)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 68516334 |
| Molecular Formula | C32H38F3N3O2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | N-[4-[4-(2-ethoxy-4-methylanilino)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOc1cc(C)ccc1NC1CCN(CCCCNC(=O)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H38F3N3O2/c1-3-40-30-22-23(2)6-15-29(30)37-28-16-20-38(21-17-28)19-5-4-18-36-31(39)26-9-7-24(8-10-26)25-11-13-27(14-12-25)32(33,34)35/h6-15,22,28,37H,3-5,16-21H2,1-2H3,(H,36,39) |
| InChIKey | VUNLGTNOLREEJM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|