C28H39FN2O2 — CID 72700353
4-[4-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]-N-pentylbenzamide (PubChem CID 72700353) has the molecular formula C28H39FN2O2 and a molecular weight of 454.63 g/mol. Its IUPAC name is 4-[4-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]-N-pentylbenzamide.
| Compound Name | 4-[4-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 72700353 |
| Molecular Formula | C28H39FN2O2 |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 4-[4-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1ccc(-c2ccc(OCC3CCN(CC(C)(C)F)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H39FN2O2/c1-4-5-6-17-30-27(32)25-9-7-23(8-10-25)24-11-13-26(14-12-24)33-20-22-15-18-31(19-16-22)21-28(2,3)29/h7-14,22H,4-6,15-21H2,1-3H3,(H,30,32) |
| InChIKey | GCYNNSSUGPBLPB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|