C30H42FNO3 — CID 123524583
4-[4-[[4-(3-fluoro-3-methylbutyl)cycloheptyl]methoxy]phenyl]-N-(4-hydroxybutyl)benzamide (PubChem CID 123524583) has the molecular formula C30H42FNO3 and a molecular weight of 483.67 g/mol. Its IUPAC name is 4-[4-[[4-(3-fluoro-3-methylbutyl)cycloheptyl]methoxy]phenyl]-N-(4-hydroxybutyl)benzamide.
| Compound Name | 4-[4-[[4-(3-fluoro-3-methylbutyl)cycloheptyl]methoxy]phenyl]-N-(4-hydroxybutyl)benzamide |
|---|---|
| PubChem CID | 123524583 |
| Molecular Formula | C30H42FNO3 |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 4-[4-[[4-(3-fluoro-3-methylbutyl)cycloheptyl]methoxy]phenyl]-N-(4-hydroxybutyl)benzamide |
| SMILES | CC(C)(F)CCC1CCCC(COc2ccc(-c3ccc(C(=O)NCCCCO)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H42FNO3/c1-30(2,31)19-18-23-6-5-7-24(9-8-23)22-35-28-16-14-26(15-17-28)25-10-12-27(13-11-25)29(34)32-20-3-4-21-33/h10-17,23-24,33H,3-9,18-22H2,1-2H3,(H,32,34) |
| InChIKey | RHVJDBVQEUHGGQ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|