C19H21NO3S — CID 95618513
4-(cyclopropylmethoxy)-N-[2-[(R)-phenylsulfinyl]ethyl]benzamide (PubChem CID 95618513) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-N-[2-[(R)-phenylsulfinyl]ethyl]benzamide.
| Compound Name | 4-(cyclopropylmethoxy)-N-[2-[(R)-phenylsulfinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 95618513 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-(cyclopropylmethoxy)-N-[2-[(R)-phenylsulfinyl]ethyl]benzamide |
| SMILES | O=C(NCC[S@@](=O)c1ccccc1)c1ccc(OCC2CC2)cc1 |
| InChI | InChI=1S/C19H21NO3S/c21-19(20-12-13-24(22)18-4-2-1-3-5-18)16-8-10-17(11-9-16)23-14-15-6-7-15/h1-5,8-11,15H,6-7,12-14H2,(H,20,21)/t24-/m1/s1 |
| InChIKey | JNDFYWMDFZLRKX-XMMPIXPASA-N |
| XLogP | 3.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |