C34H39F3N2O2 — CID 44532782
N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-3-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 44532782) has the molecular formula C34H39F3N2O2 and a molecular weight of 564.69 g/mol. Its IUPAC name is N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-3-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-3-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 44532782 |
| Molecular Formula | C34H39F3N2O2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-3-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1c(C2CCN(CCCCNC(=O)c3cccc(-c4ccc(C(F)(F)F)cc4)c3)CC2)ccc2c1CCCC2 |
| InChI | InChI=1S/C34H39F3N2O2/c1-41-32-30-10-3-2-7-25(30)13-16-31(32)26-17-21-39(22-18-26)20-5-4-19-38-33(40)28-9-6-8-27(23-28)24-11-14-29(15-12-24)34(35,36)37/h6,8-9,11-16,23,26H,2-5,7,10,17-22H2,1H3,(H,38,40) |
| InChIKey | FTUFWOXJJZODGK-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|