C27H37BN2O3 — CID 142849840
[4-[4-[4-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butylcarbamoyl]phenyl]boronic acid (PubChem CID 142849840) has the molecular formula C27H37BN2O3 and a molecular weight of 448.42 g/mol. Its IUPAC name is [4-[4-[4-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butylcarbamoyl]phenyl]boronic acid.
| Compound Name | [4-[4-[4-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 142849840 |
| Molecular Formula | C27H37BN2O3 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | [4-[4-[4-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butylcarbamoyl]phenyl]boronic acid |
| SMILES | Cc1c(C2CCN(CCCCNC(=O)c3ccc(B(O)O)cc3)CC2)ccc2c1CCCC2 |
| InChI | InChI=1S/C27H37BN2O3/c1-20-25-7-3-2-6-21(25)10-13-26(20)22-14-18-30(19-15-22)17-5-4-16-29-27(31)23-8-11-24(12-9-23)28(32)33/h8-13,22,32-33H,2-7,14-19H2,1H3,(H,29,31) |
| InChIKey | WJSHYAZBFCOFPA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|