C33H40N4O2 — CID 142849823
6-(4-methanimidoylphenyl)-N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]pyridine-3-carboxamide (PubChem CID 142849823) has the molecular formula C33H40N4O2 and a molecular weight of 524.71 g/mol. Its IUPAC name is 6-(4-methanimidoylphenyl)-N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]pyridine-3-carboxamide.
| Compound Name | 6-(4-methanimidoylphenyl)-N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142849823 |
| Molecular Formula | C33H40N4O2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 6-(4-methanimidoylphenyl)-N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]pyridine-3-carboxamide |
| SMILES | [H]/N=C/c1ccc(-c2ccc(C(=O)NCCCCN3CCC(c4ccc5c(c4OC)CCCC5)CC3)cn2)cc1 |
| InChI | InChI=1S/C33H40N4O2/c1-39-32-29-7-3-2-6-25(29)12-14-30(32)26-16-20-37(21-17-26)19-5-4-18-35-33(38)28-13-15-31(36-23-28)27-10-8-24(22-34)9-11-27/h8-15,22-23,26,34H,2-7,16-21H2,1H3,(H,35,38)/b34-22+ |
| InChIKey | PENGPJPURGTMCD-PPOKSSTKSA-N |
| XLogP | 6.02 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|