C32H38ClN3O2 — CID 87914884
N-(2-chloro-3-pyridinyl)-N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide (PubChem CID 87914884) has the molecular formula C32H38ClN3O2 and a molecular weight of 532.13 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 87914884 |
| Molecular Formula | C32H38ClN3O2 |
| Molecular Weight | 532.13 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide |
| SMILES | COc1c(C2CCN(CCCCN(C(=O)c3ccccc3)c3cccnc3Cl)CC2)ccc2c1CCCC2 |
| InChI | InChI=1S/C32H38ClN3O2/c1-38-30-27-13-6-5-10-24(27)15-16-28(30)25-17-22-35(23-18-25)20-7-8-21-36(29-14-9-19-34-31(29)33)32(37)26-11-3-2-4-12-26/h2-4,9,11-12,14-16,19,25H,5-8,10,13,17-18,20-23H2,1H3 |
| InChIKey | KKGQDKBAFUNAOE-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.13 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|