C22H29N3O2 — CID 155331858
N-[3-(4-hydroxypiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-2-carboxamide (PubChem CID 155331858) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[3-(4-hydroxypiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-2-carboxamide.
| Compound Name | N-[3-(4-hydroxypiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-2-carboxamide |
|---|---|
| PubChem CID | 155331858 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-[3-(4-hydroxypiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-2-carboxamide |
| SMILES | O=C(NCCCN1CCC(O)CC1)c1ccc2nc3c(cc2c1)CCCC3 |
| InChI | InChI=1S/C22H29N3O2/c26-19-8-12-25(13-9-19)11-3-10-23-22(27)17-6-7-21-18(15-17)14-16-4-1-2-5-20(16)24-21/h6-7,14-15,19,26H,1-5,8-13H2,(H,23,27) |
| InChIKey | NIOLNNKKYZQVNX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|