C23H30ClN3O — CID 20866087
9-chloro-N-[3-(3-methylpiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-3-carboxamide (PubChem CID 20866087) has the molecular formula C23H30ClN3O and a molecular weight of 399.97 g/mol. Its IUPAC name is 9-chloro-N-[3-(3-methylpiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-3-carboxamide.
| Compound Name | 9-chloro-N-[3-(3-methylpiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-3-carboxamide |
|---|---|
| PubChem CID | 20866087 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 9-chloro-N-[3-(3-methylpiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-3-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)c2ccc3c(Cl)c4c(nc3c2)CCCC4)C1 |
| InChI | InChI=1S/C23H30ClN3O/c1-16-6-4-12-27(15-16)13-5-11-25-23(28)17-9-10-19-21(14-17)26-20-8-3-2-7-18(20)22(19)24/h9-10,14,16H,2-8,11-13,15H2,1H3,(H,25,28) |
| InChIKey | QKZHGAGOZWJDMO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|