C32H36N4O3 — CID 20967727
2,3-bis(4-methoxyphenyl)-N-[3-(3-methylpiperidin-1-yl)propyl]quinoxaline-6-carboxamide (PubChem CID 20967727) has the molecular formula C32H36N4O3 and a molecular weight of 524.67 g/mol. Its IUPAC name is 2,3-bis(4-methoxyphenyl)-N-[3-(3-methylpiperidin-1-yl)propyl]quinoxaline-6-carboxamide.
| Compound Name | 2,3-bis(4-methoxyphenyl)-N-[3-(3-methylpiperidin-1-yl)propyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 20967727 |
| Molecular Formula | C32H36N4O3 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 2,3-bis(4-methoxyphenyl)-N-[3-(3-methylpiperidin-1-yl)propyl]quinoxaline-6-carboxamide |
| SMILES | COc1ccc(-c2nc3ccc(C(=O)NCCCN4CCCC(C)C4)cc3nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H36N4O3/c1-22-6-4-18-36(21-22)19-5-17-33-32(37)25-11-16-28-29(20-25)35-31(24-9-14-27(39-3)15-10-24)30(34-28)23-7-12-26(38-2)13-8-23/h7-16,20,22H,4-6,17-19,21H2,1-3H3,(H,33,37) |
| InChIKey | NKQZUGWFRCYMJF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|