C29H29N3O3 — CID 4162047
N-cyclohexyl-2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxamide (PubChem CID 4162047) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-cyclohexyl-2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxamide.
| Compound Name | N-cyclohexyl-2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 4162047 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-cyclohexyl-2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxamide |
| SMILES | COc1ccc(-c2nc3ccc(C(=O)NC4CCCCC4)cc3nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H29N3O3/c1-34-23-13-8-19(9-14-23)27-28(20-10-15-24(35-2)16-11-20)32-26-18-21(12-17-25(26)31-27)29(33)30-22-6-4-3-5-7-22/h8-18,22H,3-7H2,1-2H3,(H,30,33) |
| InChIKey | DAWTVSUZFAYWNZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |