C22H19N3O3 — CID 3236343
N-cyclopentyl-2,3-bis(furan-2-yl)quinoxaline-6-carboxamide (PubChem CID 3236343) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-cyclopentyl-2,3-bis(furan-2-yl)quinoxaline-6-carboxamide.
| Compound Name | N-cyclopentyl-2,3-bis(furan-2-yl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 3236343 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-cyclopentyl-2,3-bis(furan-2-yl)quinoxaline-6-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccc2nc(-c3ccco3)c(-c3ccco3)nc2c1 |
| InChI | InChI=1S/C22H19N3O3/c26-22(23-15-5-1-2-6-15)14-9-10-16-17(13-14)25-21(19-8-4-12-28-19)20(24-16)18-7-3-11-27-18/h3-4,7-13,15H,1-2,5-6H2,(H,23,26) |
| InChIKey | KVIJGHOCSOYHKK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |