C13H13ClN2OS — CID 100786731
2-chloro-N-cyclopentyl-1,3-benzothiazole-5-carboxamide (PubChem CID 100786731) has the molecular formula C13H13ClN2OS and a molecular weight of 280.78 g/mol. Its IUPAC name is 2-chloro-N-cyclopentyl-1,3-benzothiazole-5-carboxamide.
| Compound Name | 2-chloro-N-cyclopentyl-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 100786731 |
| Molecular Formula | C13H13ClN2OS |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-chloro-N-cyclopentyl-1,3-benzothiazole-5-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccc2sc(Cl)nc2c1 |
| InChI | InChI=1S/C13H13ClN2OS/c14-13-16-10-7-8(5-6-11(10)18-13)12(17)15-9-3-1-2-4-9/h5-7,9H,1-4H2,(H,15,17) |
| InChIKey | OLYWJGQDCHUZMZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |