C13H13ClN2O2S — CID 133167285
2-chloro-N-(oxolan-2-ylmethyl)-1,3-benzothiazole-5-carboxamide (PubChem CID 133167285) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is 2-chloro-N-(oxolan-2-ylmethyl)-1,3-benzothiazole-5-carboxamide.
| Compound Name | 2-chloro-N-(oxolan-2-ylmethyl)-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 133167285 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-chloro-N-(oxolan-2-ylmethyl)-1,3-benzothiazole-5-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1ccc2sc(Cl)nc2c1 |
| InChI | InChI=1S/C13H13ClN2O2S/c14-13-16-10-6-8(3-4-11(10)19-13)12(17)15-7-9-2-1-5-18-9/h3-4,6,9H,1-2,5,7H2,(H,15,17) |
| InChIKey | YERHLAKNARBGEG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |