C15H19ClN4OS — CID 119129959
1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 119129959) has the molecular formula C15H19ClN4OS and a molecular weight of 338.86 g/mol. Its IUPAC name is 1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119129959 |
| Molecular Formula | C15H19ClN4OS |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1nc2cc(Cl)ccc2s1)NCC1CCCO1 |
| InChI | InChI=1S/C15H19ClN4OS/c1-17-15(18-8-11-3-2-6-21-11)19-9-14-20-12-7-10(16)4-5-13(12)22-14/h4-5,7,11H,2-3,6,8-9H2,1H3,(H2,17,18,19) |
| InChIKey | FGDCSGDIJDELMR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|