C21H21N3O2S — CID 4159999
2-benzamido-N-cyclohexyl-1,3-benzothiazole-6-carboxamide (PubChem CID 4159999) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 2-benzamido-N-cyclohexyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-benzamido-N-cyclohexyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 4159999 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-benzamido-N-cyclohexyl-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(Nc1nc2ccc(C(=O)NC3CCCCC3)cc2s1)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O2S/c25-19(14-7-3-1-4-8-14)24-21-23-17-12-11-15(13-18(17)27-21)20(26)22-16-9-5-2-6-10-16/h1,3-4,7-8,11-13,16H,2,5-6,9-10H2,(H,22,26)(H,23,24,25) |
| InChIKey | DNSXKLWIAPPUDZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |