C27H26N4O3S — CID 134203913
cyclohexyl N-[5-(2-benzamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate (PubChem CID 134203913) has the molecular formula C27H26N4O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is cyclohexyl N-[5-(2-benzamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate.
| Compound Name | cyclohexyl N-[5-(2-benzamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 134203913 |
| Molecular Formula | C27H26N4O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | cyclohexyl N-[5-(2-benzamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate |
| SMILES | Cc1ncc(-c2ccc3nc(NC(=O)c4ccccc4)sc3c2)cc1NC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C27H26N4O3S/c1-17-23(30-27(33)34-21-10-6-3-7-11-21)14-20(16-28-17)19-12-13-22-24(15-19)35-26(29-22)31-25(32)18-8-4-2-5-9-18/h2,4-5,8-9,12-16,21H,3,6-7,10-11H2,1H3,(H,30,33)(H,29,31,32) |
| InChIKey | YUVCSHDVLGVHBJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |