C23H19ClN4OS — CID 122185882
N-[2-chloro-5-[2-(cyclopropylmethylamino)-1,3-benzothiazol-6-yl]-3-pyridinyl]benzamide (PubChem CID 122185882) has the molecular formula C23H19ClN4OS and a molecular weight of 434.95 g/mol. Its IUPAC name is N-[2-chloro-5-[2-(cyclopropylmethylamino)-1,3-benzothiazol-6-yl]-3-pyridinyl]benzamide.
| Compound Name | N-[2-chloro-5-[2-(cyclopropylmethylamino)-1,3-benzothiazol-6-yl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 122185882 |
| Molecular Formula | C23H19ClN4OS |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[2-chloro-5-[2-(cyclopropylmethylamino)-1,3-benzothiazol-6-yl]-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1cc(-c2ccc3nc(NCC4CC4)sc3c2)cnc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H19ClN4OS/c24-21-19(27-22(29)15-4-2-1-3-5-15)10-17(13-25-21)16-8-9-18-20(11-16)30-23(28-18)26-12-14-6-7-14/h1-5,8-11,13-14H,6-7,12H2,(H,26,28)(H,27,29) |
| InChIKey | WTIQLXISMIJHAK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|