C15H13ClN4O3S2 — CID 44623339
N-[6-[6-chloro-5-(methanesulfonamido)-3-pyridinyl]-1,3-benzothiazol-2-yl]acetamide (PubChem CID 44623339) has the molecular formula C15H13ClN4O3S2 and a molecular weight of 396.88 g/mol. Its IUPAC name is N-[6-[6-chloro-5-(methanesulfonamido)-3-pyridinyl]-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[6-[6-chloro-5-(methanesulfonamido)-3-pyridinyl]-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 44623339 |
| Molecular Formula | C15H13ClN4O3S2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | N-[6-[6-chloro-5-(methanesulfonamido)-3-pyridinyl]-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2ccc(-c3cnc(Cl)c(NS(C)(=O)=O)c3)cc2s1 |
| InChI | InChI=1S/C15H13ClN4O3S2/c1-8(21)18-15-19-11-4-3-9(6-13(11)24-15)10-5-12(14(16)17-7-10)20-25(2,22)23/h3-7,20H,1-2H3,(H,18,19,21) |
| InChIKey | PBJUXNIDOLNGHT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|