C13H9ClN4OS — CID 51354316
N-[6-(6-chloropyrazin-2-yl)-1,3-benzothiazol-2-yl]acetamide (PubChem CID 51354316) has the molecular formula C13H9ClN4OS and a molecular weight of 304.76 g/mol. Its IUPAC name is N-[6-(6-chloropyrazin-2-yl)-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[6-(6-chloropyrazin-2-yl)-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 51354316 |
| Molecular Formula | C13H9ClN4OS |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | N-[6-(6-chloropyrazin-2-yl)-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2ccc(-c3cncc(Cl)n3)cc2s1 |
| InChI | InChI=1S/C13H9ClN4OS/c1-7(19)16-13-18-9-3-2-8(4-11(9)20-13)10-5-15-6-12(14)17-10/h2-6H,1H3,(H,16,18,19) |
| InChIKey | OZKOKJBZFMDYSY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |